C21H17ClN4S — CID 112797756
2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]quinoline (PubChem CID 112797756) has the molecular formula C21H17ClN4S and a molecular weight of 392.92 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]quinoline.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]quinoline |
|---|---|
| PubChem CID | 112797756 |
| Molecular Formula | C21H17ClN4S |
| Molecular Weight | 392.92 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]quinoline |
| SMILES | C=CCn1c(SCc2ccc3ccccc3n2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClN4S/c1-2-13-26-20(16-7-10-17(22)11-8-16)24-25-21(26)27-14-18-12-9-15-5-3-4-6-19(15)23-18/h2-12H,1,13-14H2 |
| InChIKey | GIFUUSBWDYIAFV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.92 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|