C18H14BrN5OS2 — CID 136963130
2-[[5-(4-bromophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 136963130) has the molecular formula C18H14BrN5OS2 and a molecular weight of 460.38 g/mol. Its IUPAC name is 2-[[5-(4-bromophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[[5-(4-bromophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136963130 |
| Molecular Formula | C18H14BrN5OS2 |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | 2-[[5-(4-bromophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2nc3ccsc3c(=O)[nH]2)nnc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H14BrN5OS2/c1-2-8-24-16(11-3-5-12(19)6-4-11)22-23-18(24)27-10-14-20-13-7-9-26-15(13)17(25)21-14/h2-7,9H,1,8,10H2,(H,20,21,25) |
| InChIKey | FUWAMUDWHRUGQO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|