C25H21FN2S — CID 3843457
2-[(3-fluorophenyl)methylsulfanyl]-4,5-diphenyl-1-prop-2-enylimidazole (PubChem CID 3843457) has the molecular formula C25H21FN2S and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methylsulfanyl]-4,5-diphenyl-1-prop-2-enylimidazole.
| Compound Name | 2-[(3-fluorophenyl)methylsulfanyl]-4,5-diphenyl-1-prop-2-enylimidazole |
|---|---|
| PubChem CID | 3843457 |
| Molecular Formula | C25H21FN2S |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-[(3-fluorophenyl)methylsulfanyl]-4,5-diphenyl-1-prop-2-enylimidazole |
| SMILES | C=CCn1c(SCc2cccc(F)c2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H21FN2S/c1-2-16-28-24(21-13-7-4-8-14-21)23(20-11-5-3-6-12-20)27-25(28)29-18-19-10-9-15-22(26)17-19/h2-15,17H,1,16,18H2 |
| InChIKey | AQVZXCXDHQKQNK-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|