C23H20BrN2S- — CID 21203040
4-(2,5-dimethylphenyl)-N,3-diphenyl-1,3-thiazol-2-imine bromide (PubChem CID 21203040) has the molecular formula C23H20BrN2S- and a molecular weight of 436.40 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-N,3-diphenyl-1,3-thiazol-2-imine bromide.
| Compound Name | 4-(2,5-dimethylphenyl)-N,3-diphenyl-1,3-thiazol-2-imine bromide |
|---|---|
| PubChem CID | 21203040 |
| Molecular Formula | C23H20BrN2S- |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-N,3-diphenyl-1,3-thiazol-2-imine bromide |
| SMILES | Cc1ccc(C)c(-c2cs/c(=N\c3ccccc3)n2-c2ccccc2)c1.[Br-] |
| InChI | InChI=1S/C23H20N2S.BrH/c1-17-13-14-18(2)21(15-17)22-16-26-23(24-19-9-5-3-6-10-19)25(22)20-11-7-4-8-12-20;/h3-16H,1-2H3;1H/p-1/b24-23-; |
| InChIKey | PSFUMFHTIMYNRH-DCXSSQDFSA-M |
| XLogP | 3.06 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|