C9H10N2O2S2 — CID 5373904
(2Z)-2-methoxysulfinylimino-3-methyl-1,3-benzothiazole (PubChem CID 5373904) has the molecular formula C9H10N2O2S2 and a molecular weight of 242.33 g/mol. Its IUPAC name is (2Z)-2-methoxysulfinylimino-3-methyl-1,3-benzothiazole.
| Compound Name | (2Z)-2-methoxysulfinylimino-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 5373904 |
| Molecular Formula | C9H10N2O2S2 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | (2Z)-2-methoxysulfinylimino-3-methyl-1,3-benzothiazole |
| SMILES | COS(=O)/N=c1\sc2ccccc2n1C |
| InChI | InChI=1S/C9H10N2O2S2/c1-11-7-5-3-4-6-8(7)14-9(11)10-15(12)13-2/h3-6H,1-2H3/b10-9- |
| InChIKey | AIDKYNPKEJBCTI-KTKRTIGZSA-N |
| XLogP | 1.37 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |