C8H8FN3O2S2 — CID 6167748
(2E)-2-hydrazinylidene-3-methyl-1,3-benzothiazole-5-sulfonyl fluoride (PubChem CID 6167748) has the molecular formula C8H8FN3O2S2 and a molecular weight of 261.30 g/mol. Its IUPAC name is (2E)-2-hydrazinylidene-3-methyl-1,3-benzothiazole-5-sulfonyl fluoride.
| Compound Name | (2E)-2-hydrazinylidene-3-methyl-1,3-benzothiazole-5-sulfonyl fluoride |
|---|---|
| PubChem CID | 6167748 |
| Molecular Formula | C8H8FN3O2S2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | (2E)-2-hydrazinylidene-3-methyl-1,3-benzothiazole-5-sulfonyl fluoride |
| SMILES | Cn1/c(=N\N)sc2ccc(S(=O)(=O)F)cc21 |
| InChI | InChI=1S/C8H8FN3O2S2/c1-12-6-4-5(16(9,13)14)2-3-7(6)15-8(12)11-10/h2-4H,10H2,1H3/b11-8+ |
| InChIKey | XFRKBBZYZWZWFX-DHZHZOJOSA-N |
| XLogP | 0.67 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|