C10H13N3OS — CID 54058185
(6-ethoxy-3-methyl-1,3-benzothiazol-2-ylidene)hydrazine (PubChem CID 54058185) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is (6-ethoxy-3-methyl-1,3-benzothiazol-2-ylidene)hydrazine.
| Compound Name | (6-ethoxy-3-methyl-1,3-benzothiazol-2-ylidene)hydrazine |
|---|---|
| PubChem CID | 54058185 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (6-ethoxy-3-methyl-1,3-benzothiazol-2-ylidene)hydrazine |
| SMILES | CCOc1ccc2c(c1)sc(=NN)n2C |
| InChI | InChI=1S/C10H13N3OS/c1-3-14-7-4-5-8-9(6-7)15-10(12-11)13(8)2/h4-6H,3,11H2,1-2H3 |
| InChIKey | LXTQEBJJIZFQMX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|