C8H8KN3O3S2 — CID 102268613
potassium (2E)-2-hydrazinylidene-3-methyl-1,3-benzothiazole-4-sulfonate (PubChem CID 102268613) has the molecular formula C8H8KN3O3S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is potassium (2E)-2-hydrazinylidene-3-methyl-1,3-benzothiazole-4-sulfonate.
| Compound Name | potassium (2E)-2-hydrazinylidene-3-methyl-1,3-benzothiazole-4-sulfonate |
|---|---|
| PubChem CID | 102268613 |
| Molecular Formula | C8H8KN3O3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | potassium (2E)-2-hydrazinylidene-3-methyl-1,3-benzothiazole-4-sulfonate |
| SMILES | Cn1/c(=N\N)sc2cccc(S(=O)(=O)[O-])c21.[K+] |
| InChI | InChI=1S/C8H9N3O3S2.K/c1-11-7-5(15-8(11)10-9)3-2-4-6(7)16(12,13)14;/h2-4H,9H2,1H3,(H,12,13,14);/q;+1/p-1/b10-8+; |
| InChIKey | SJLBLAQMFIBXGZ-VRTOBVRTSA-M |
| XLogP | -3.08 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|