C36H34N6S2+2 — CID 89166067
(E)-N-[(E)-[3-[3-[4-(1-benzylpyridin-1-ium-2-yl)pyridin-1-ium-1-yl]propyl]-1,3-benzothiazol-2-ylidene]amino]-3-ethyl-1,3-benzothiazol-2-imine (PubChem CID 89166067) has the molecular formula C36H34N6S2+2 and a molecular weight of 614.84 g/mol. Its IUPAC name is (E)-N-[(E)-[3-[3-[4-(1-benzylpyridin-1-ium-2-yl)pyridin-1-ium-1-yl]propyl]-1,3-benzothiazol-2-ylidene]amino]-3-ethyl-1,3-benzothiazol-2-imine.
| Compound Name | (E)-N-[(E)-[3-[3-[4-(1-benzylpyridin-1-ium-2-yl)pyridin-1-ium-1-yl]propyl]-1,3-benzothiazol-2-ylidene]amino]-3-ethyl-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 89166067 |
| Molecular Formula | C36H34N6S2+2 |
| Molecular Weight | 614.84 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | (E)-N-[(E)-[3-[3-[4-(1-benzylpyridin-1-ium-2-yl)pyridin-1-ium-1-yl]propyl]-1,3-benzothiazol-2-ylidene]amino]-3-ethyl-1,3-benzothiazol-2-imine |
| SMILES | CCn1/c(=N\N=c2\sc3ccccc3n2CCC[n+]2ccc(-c3cccc[n+]3Cc3ccccc3)cc2)sc2ccccc21 |
| InChI | InChI=1S/C36H34N6S2/c1-2-41-31-16-6-8-18-33(31)43-35(41)37-38-36-42(32-17-7-9-19-34(32)44-36)24-12-22-39-25-20-29(21-26-39)30-15-10-11-23-40(30)27-28-13-4-3-5-14-28/h3-11,13-21,23,25-26H,2,12,22,24,27H2,1H3/q+2/b37-35+,38-36+ |
| InChIKey | MWHLPFPPDXWQJV-ATXIYDNESA-N |
| XLogP | 6.54 |
| TPSA | 42.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.84 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|