C35H44N6S2+2 — CID 172947580
3-[4-[4-(1-butylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]butyl]-2H-1,3-benzothiazole;methane;(E)-3-methyl-N-(methylideneamino)-1,3-benzothiazol-2-imine (PubChem CID 172947580) has the molecular formula C35H44N6S2+2 and a molecular weight of 612.91 g/mol. Its IUPAC name is 3-[4-[4-(1-butylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]butyl]-2H-1,3-benzothiazole;methane;(E)-3-methyl-N-(methylideneamino)-1,3-benzothiazol-2-imine.
| Compound Name | 3-[4-[4-(1-butylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]butyl]-2H-1,3-benzothiazole;methane;(E)-3-methyl-N-(methylideneamino)-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 172947580 |
| Molecular Formula | C35H44N6S2+2 |
| Molecular Weight | 612.91 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | 3-[4-[4-(1-butylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]butyl]-2H-1,3-benzothiazole;methane;(E)-3-methyl-N-(methylideneamino)-1,3-benzothiazol-2-imine |
| SMILES | C.C=N/N=c1/sc2ccccc2n1C.CCCC[n+]1ccc(-c2cc[n+](CCCCN3CSc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C25H31N3S.C9H9N3S.CH4/c1-2-3-14-26-17-10-22(11-18-26)23-12-19-27(20-13-23)15-6-7-16-28-21-29-25-9-5-4-8-24(25)28;1-10-11-9-12(2)7-5-3-4-6-8(7)13-9;/h4-5,8-13,17-20H,2-3,6-7,14-16,21H2,1H3;3-6H,1H2,2H3;1H4/q+2;;/b;11-9+; |
| InChIKey | DOWGHQKQAHIXLZ-XHNJQLCBSA-N |
| XLogP | 7.47 |
| TPSA | 40.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.91 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|