C14H16F3N2O2S+ — CID 3553469
1-ethyl-2-methyl-3-prop-2-enyl-5-(trifluoromethylsulfonyl)benzimidazol-1-ium (PubChem CID 3553469) has the molecular formula C14H16F3N2O2S+ and a molecular weight of 333.36 g/mol. Its IUPAC name is 1-ethyl-2-methyl-3-prop-2-enyl-5-(trifluoromethylsulfonyl)benzimidazol-1-ium.
| Compound Name | 1-ethyl-2-methyl-3-prop-2-enyl-5-(trifluoromethylsulfonyl)benzimidazol-1-ium |
|---|---|
| PubChem CID | 3553469 |
| Molecular Formula | C14H16F3N2O2S+ |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 1-ethyl-2-methyl-3-prop-2-enyl-5-(trifluoromethylsulfonyl)benzimidazol-1-ium |
| SMILES | C=CCn1c(C)[n+](CC)c2ccc(S(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C14H16F3N2O2S/c1-4-8-19-10(3)18(5-2)12-7-6-11(9-13(12)19)22(20,21)14(15,16)17/h4,6-7,9H,1,5,8H2,2-3H3/q+1 |
| InChIKey | LWKZOHYXVDXDJX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|