C19H23IN2O2 — CID 123132390
1-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)-3-phenoxypropan-2-ol iodide (PubChem CID 123132390) has the molecular formula C19H23IN2O2 and a molecular weight of 438.31 g/mol. Its IUPAC name is 1-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)-3-phenoxypropan-2-ol iodide.
| Compound Name | 1-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)-3-phenoxypropan-2-ol iodide |
|---|---|
| PubChem CID | 123132390 |
| Molecular Formula | C19H23IN2O2 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1-(3-ethyl-2-methylbenzimidazol-1-ium-1-yl)-3-phenoxypropan-2-ol iodide |
| SMILES | CCn1c(C)[n+](CC(O)COc2ccccc2)c2ccccc21.[I-] |
| InChI | InChI=1S/C19H23N2O2.HI/c1-3-20-15(2)21(19-12-8-7-11-18(19)20)13-16(22)14-23-17-9-5-4-6-10-17;/h4-12,16,22H,3,13-14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NIHOSQYBGBJDIZ-UHFFFAOYSA-M |
| XLogP | -0.30 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|