C19H21ClN3O2+ — CID 7361851
(2S)-1-(2-amino-3-prop-2-enylbenzimidazol-1-ium-1-yl)-3-(4-chlorophenoxy)propan-2-ol (PubChem CID 7361851) has the molecular formula C19H21ClN3O2+ and a molecular weight of 358.85 g/mol. Its IUPAC name is (2S)-1-(2-amino-3-prop-2-enylbenzimidazol-1-ium-1-yl)-3-(4-chlorophenoxy)propan-2-ol.
| Compound Name | (2S)-1-(2-amino-3-prop-2-enylbenzimidazol-1-ium-1-yl)-3-(4-chlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 7361851 |
| Molecular Formula | C19H21ClN3O2+ |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (2S)-1-(2-amino-3-prop-2-enylbenzimidazol-1-ium-1-yl)-3-(4-chlorophenoxy)propan-2-ol |
| SMILES | C=CCn1c(N)[n+](C[C@H](O)COc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H20ClN3O2/c1-2-11-22-17-5-3-4-6-18(17)23(19(22)21)12-15(24)13-25-16-9-7-14(20)8-10-16/h2-10,15,21,24H,1,11-13H2/p+1/t15-/m0/s1 |
| InChIKey | UIEXGTBWIWQHIP-HNNXBMFYSA-O |
| XLogP | 2.79 |
| TPSA | 64.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|