C12H16ClN3O — CID 44658060
2-(2-amino-3-prop-2-enylbenzimidazol-1-ium-1-yl)ethanol chloride (PubChem CID 44658060) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is 2-(2-amino-3-prop-2-enylbenzimidazol-1-ium-1-yl)ethanol chloride.
| Compound Name | 2-(2-amino-3-prop-2-enylbenzimidazol-1-ium-1-yl)ethanol chloride |
|---|---|
| PubChem CID | 44658060 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-(2-amino-3-prop-2-enylbenzimidazol-1-ium-1-yl)ethanol chloride |
| SMILES | C=CCn1c(N)[n+](CCO)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C12H15N3O.ClH/c1-2-7-14-10-5-3-4-6-11(10)15(8-9-16)12(14)13;/h2-6,13,16H,1,7-9H2;1H |
| InChIKey | GOVJVPZPEXNQAL-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 55.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|