C19H18BrN3 — CID 139073992
2-[(2-methyl-3-prop-2-enylbenzimidazol-1-ium-1-yl)methyl]benzonitrile bromide (PubChem CID 139073992) has the molecular formula C19H18BrN3 and a molecular weight of 368.28 g/mol. Its IUPAC name is 2-[(2-methyl-3-prop-2-enylbenzimidazol-1-ium-1-yl)methyl]benzonitrile bromide.
| Compound Name | 2-[(2-methyl-3-prop-2-enylbenzimidazol-1-ium-1-yl)methyl]benzonitrile bromide |
|---|---|
| PubChem CID | 139073992 |
| Molecular Formula | C19H18BrN3 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-[(2-methyl-3-prop-2-enylbenzimidazol-1-ium-1-yl)methyl]benzonitrile bromide |
| SMILES | C=CCn1c(C)[n+](Cc2ccccc2C#N)c2ccccc21.[Br-] |
| InChI | InChI=1S/C19H18N3.BrH/c1-3-12-21-15(2)22(19-11-7-6-10-18(19)21)14-17-9-5-4-8-16(17)13-20;/h3-11H,1,12,14H2,2H3;1H/q+1;/p-1 |
| InChIKey | FXWIEGZNKZRXFA-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 32.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|