C16H15NO4S — CID 2309613
3-[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-1,3-thiazolidine-2,4-dione (PubChem CID 2309613) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is 3-[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2309613 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 3-[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1C[C@H](O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C16H15NO4S/c18-12(8-17-15(19)10-22-16(17)20)9-21-14-7-3-5-11-4-1-2-6-13(11)14/h1-7,12,18H,8-10H2/t12-/m0/s1 |
| InChIKey | ZAVBRPLTLZBVCC-LBPRGKRZSA-N |
| XLogP | 2.27 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|