C23H28N2O4 — CID 26008305
8-ethyl-3-[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 26008305) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 8-ethyl-3-[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-ethyl-3-[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26008305 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 8-ethyl-3-[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCC1CCC2(CC1)NC(=O)N(C[C@H](O)COc1cccc3ccccc13)C2=O |
| InChI | InChI=1S/C23H28N2O4/c1-2-16-10-12-23(13-11-16)21(27)25(22(28)24-23)14-18(26)15-29-20-9-5-7-17-6-3-4-8-19(17)20/h3-9,16,18,26H,2,10-15H2,1H3,(H,24,28)/t16?,18-,23?/m0/s1 |
| InChIKey | SSNSNNPZOURJSJ-HRZDDSQGSA-N |
| XLogP | 3.47 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|