C20H25N2O3+ — CID 3144459
1-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)-3-(2-methoxyphenoxy)propan-2-ol (PubChem CID 3144459) has the molecular formula C20H25N2O3+ and a molecular weight of 341.43 g/mol. Its IUPAC name is 1-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)-3-(2-methoxyphenoxy)propan-2-ol.
| Compound Name | 1-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)-3-(2-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 3144459 |
| Molecular Formula | C20H25N2O3+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)-3-(2-methoxyphenoxy)propan-2-ol |
| SMILES | CCc1n(CC(O)COc2ccccc2OC)c2ccccc2[n+]1C |
| InChI | InChI=1S/C20H25N2O3/c1-4-20-21(2)16-9-5-6-10-17(16)22(20)13-15(23)14-25-19-12-8-7-11-18(19)24-3/h5-12,15,23H,4,13-14H2,1-3H3/q+1 |
| InChIKey | FFANTUGBAOPFOV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|