C19H22ClIN2O2 — CID 2885213
1-(3-chlorophenoxy)-3-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide (PubChem CID 2885213) has the molecular formula C19H22ClIN2O2 and a molecular weight of 472.75 g/mol. Its IUPAC name is 1-(3-chlorophenoxy)-3-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide.
| Compound Name | 1-(3-chlorophenoxy)-3-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide |
|---|---|
| PubChem CID | 2885213 |
| Molecular Formula | C19H22ClIN2O2 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | 1-(3-chlorophenoxy)-3-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide |
| SMILES | CCc1n(CC(O)COc2cccc(Cl)c2)c2ccccc2[n+]1C.[I-] |
| InChI | InChI=1S/C19H22ClN2O2.HI/c1-3-19-21(2)17-9-4-5-10-18(17)22(19)12-15(23)13-24-16-8-6-7-14(20)11-16;/h4-11,15,23H,3,12-13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | XUOGCMXLJZFVKG-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|