C15H22F3N5O3S — CID 11603923
2-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N-methyl-N-(methyldiazenyl)propan-2-amine;trifluoromethanesulfonate (PubChem CID 11603923) has the molecular formula C15H22F3N5O3S and a molecular weight of 409.43 g/mol. Its IUPAC name is 2-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N-methyl-N-(methyldiazenyl)propan-2-amine;trifluoromethanesulfonate.
| Compound Name | 2-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N-methyl-N-(methyldiazenyl)propan-2-amine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11603923 |
| Molecular Formula | C15H22F3N5O3S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N-methyl-N-(methyldiazenyl)propan-2-amine;trifluoromethanesulfonate |
| SMILES | C/N=N/N(C)C(C)(C)c1n(C)c2ccccc2[n+]1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H22N5.CHF3O3S/c1-14(2,19(6)16-15-3)13-17(4)11-9-7-8-10-12(11)18(13)5;2-1(3,4)8(5,6)7/h7-10H,1-6H3;(H,5,6,7)/q+1;/p-1/b16-15+; |
| InChIKey | SASIZNQVUZPMKK-GEEYTBSJSA-M |
| XLogP | 2.22 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|