C18H21Br3N2O6S — CID 22887797
1-octyl-2-(tribromomethylsulfonyl)benzimidazole-5,6-dicarboxylic acid (PubChem CID 22887797) has the molecular formula C18H21Br3N2O6S and a molecular weight of 633.15 g/mol. Its IUPAC name is 1-octyl-2-(tribromomethylsulfonyl)benzimidazole-5,6-dicarboxylic acid.
| Compound Name | 1-octyl-2-(tribromomethylsulfonyl)benzimidazole-5,6-dicarboxylic acid |
|---|---|
| PubChem CID | 22887797 |
| Molecular Formula | C18H21Br3N2O6S |
| Molecular Weight | 633.15 g/mol |
| Exact Mass | 629.87 |
| IUPAC Name | 1-octyl-2-(tribromomethylsulfonyl)benzimidazole-5,6-dicarboxylic acid |
| SMILES | CCCCCCCCn1c(S(=O)(=O)C(Br)(Br)Br)nc2cc(C(=O)O)c(C(=O)O)cc21 |
| InChI | InChI=1S/C18H21Br3N2O6S/c1-2-3-4-5-6-7-8-23-14-10-12(16(26)27)11(15(24)25)9-13(14)22-17(23)30(28,29)18(19,20)21/h9-10H,2-8H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | YXDANHXSOLVOFA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.15 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|