C12H13Br3N2O2S — CID 20741069
1-ethyl-5,6-dimethyl-2-(tribromomethylsulfonyl)benzimidazole (PubChem CID 20741069) has the molecular formula C12H13Br3N2O2S and a molecular weight of 489.03 g/mol. Its IUPAC name is 1-ethyl-5,6-dimethyl-2-(tribromomethylsulfonyl)benzimidazole.
| Compound Name | 1-ethyl-5,6-dimethyl-2-(tribromomethylsulfonyl)benzimidazole |
|---|---|
| PubChem CID | 20741069 |
| Molecular Formula | C12H13Br3N2O2S |
| Molecular Weight | 489.03 g/mol |
| Exact Mass | 485.82 |
| IUPAC Name | 1-ethyl-5,6-dimethyl-2-(tribromomethylsulfonyl)benzimidazole |
| SMILES | CCn1c(S(=O)(=O)C(Br)(Br)Br)nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C12H13Br3N2O2S/c1-4-17-10-6-8(3)7(2)5-9(10)16-11(17)20(18,19)12(13,14)15/h5-6H,4H2,1-3H3 |
| InChIKey | OQBJIPWWPCEIRA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.03 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|