C17H23IN2O5 — CID 52997533
ethyl 3-(2-acetyloxyethyl)-1-(2-hydroxyethyl)-2-methylbenzimidazol-1-ium-5-carboxylate iodide (PubChem CID 52997533) has the molecular formula C17H23IN2O5 and a molecular weight of 462.28 g/mol. Its IUPAC name is ethyl 3-(2-acetyloxyethyl)-1-(2-hydroxyethyl)-2-methylbenzimidazol-1-ium-5-carboxylate iodide.
| Compound Name | ethyl 3-(2-acetyloxyethyl)-1-(2-hydroxyethyl)-2-methylbenzimidazol-1-ium-5-carboxylate iodide |
|---|---|
| PubChem CID | 52997533 |
| Molecular Formula | C17H23IN2O5 |
| Molecular Weight | 462.28 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | ethyl 3-(2-acetyloxyethyl)-1-(2-hydroxyethyl)-2-methylbenzimidazol-1-ium-5-carboxylate iodide |
| SMILES | CCOC(=O)c1ccc2c(c1)n(CCOC(C)=O)c(C)[n+]2CCO.[I-] |
| InChI | InChI=1S/C17H23N2O5.HI/c1-4-23-17(22)14-5-6-15-16(11-14)19(8-10-24-13(3)21)12(2)18(15)7-9-20;/h5-6,11,20H,4,7-10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZDUMQNGQJGLINU-UHFFFAOYSA-M |
| XLogP | -2.03 |
| TPSA | 81.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.28 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|