C12H15NO6 — CID 11402949
diethyl (Z)-2-(2,5-dioxopyrrolidin-1-yl)but-2-enedioate (PubChem CID 11402949) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is diethyl (Z)-2-(2,5-dioxopyrrolidin-1-yl)but-2-enedioate.
| Compound Name | diethyl (Z)-2-(2,5-dioxopyrrolidin-1-yl)but-2-enedioate |
|---|---|
| PubChem CID | 11402949 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | diethyl (Z)-2-(2,5-dioxopyrrolidin-1-yl)but-2-enedioate |
| SMILES | CCOC(=O)/C=C(/C(=O)OCC)N1C(=O)CCC1=O |
| InChI | InChI=1S/C12H15NO6/c1-3-18-11(16)7-8(12(17)19-4-2)13-9(14)5-6-10(13)15/h7H,3-6H2,1-2H3/b8-7- |
| InChIKey | IYJWPMKVCQCQLJ-FPLPWBNLSA-N |
| XLogP | 0.15 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|