C15H15IN2O6 — CID 5470765
diethyl (E)-2-(5-iodo-2,4-dioxo-3-prop-2-ynylpyrimidin-1-yl)but-2-enedioate (PubChem CID 5470765) has the molecular formula C15H15IN2O6 and a molecular weight of 446.20 g/mol. Its IUPAC name is diethyl (E)-2-(5-iodo-2,4-dioxo-3-prop-2-ynylpyrimidin-1-yl)but-2-enedioate.
| Compound Name | diethyl (E)-2-(5-iodo-2,4-dioxo-3-prop-2-ynylpyrimidin-1-yl)but-2-enedioate |
|---|---|
| PubChem CID | 5470765 |
| Molecular Formula | C15H15IN2O6 |
| Molecular Weight | 446.20 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | diethyl (E)-2-(5-iodo-2,4-dioxo-3-prop-2-ynylpyrimidin-1-yl)but-2-enedioate |
| SMILES | C#CCn1c(=O)c(I)cn(/C(=C/C(=O)OCC)C(=O)OCC)c1=O |
| InChI | InChI=1S/C15H15IN2O6/c1-4-7-17-13(20)10(16)9-18(15(17)22)11(14(21)24-6-3)8-12(19)23-5-2/h1,8-9H,5-7H2,2-3H3/b11-8+ |
| InChIKey | FNLWEUUYSUQORI-DHZHZOJOSA-N |
| XLogP | 0.21 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|