C12H13IN2O6 — CID 15404774
diethyl (E)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)but-2-enedioate (PubChem CID 15404774) has the molecular formula C12H13IN2O6 and a molecular weight of 408.15 g/mol. Its IUPAC name is diethyl (E)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)but-2-enedioate.
| Compound Name | diethyl (E)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)but-2-enedioate |
|---|---|
| PubChem CID | 15404774 |
| Molecular Formula | C12H13IN2O6 |
| Molecular Weight | 408.15 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | diethyl (E)-2-(5-iodo-2,4-dioxopyrimidin-1-yl)but-2-enedioate |
| SMILES | CCOC(=O)/C=C(\C(=O)OCC)n1cc(I)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H13IN2O6/c1-3-20-9(16)5-8(11(18)21-4-2)15-6-7(13)10(17)14-12(15)19/h5-6H,3-4H2,1-2H3,(H,14,17,19)/b8-5+ |
| InChIKey | LHMOAAILNZAIPL-VMPITWQZSA-N |
| XLogP | 0.11 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|