C10H11BrN2O4 — CID 80546453
ethyl (E)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enoate (PubChem CID 80546453) has the molecular formula C10H11BrN2O4 and a molecular weight of 303.11 g/mol. Its IUPAC name is ethyl (E)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enoate.
| Compound Name | ethyl (E)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enoate |
|---|---|
| PubChem CID | 80546453 |
| Molecular Formula | C10H11BrN2O4 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | ethyl (E)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enoate |
| SMILES | CCOC(=O)/C=C/Cn1cc(Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H11BrN2O4/c1-2-17-8(14)4-3-5-13-6-7(11)9(15)12-10(13)16/h3-4,6H,2,5H2,1H3,(H,12,15,16)/b4-3+ |
| InChIKey | ZGANMJDQHCHHCV-ONEGZZNKSA-N |
| XLogP | 0.42 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|