C8H10BrN2O5P — CID 50993876
[(Z)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid (PubChem CID 50993876) has the molecular formula C8H10BrN2O5P and a molecular weight of 325.06 g/mol. Its IUPAC name is [(Z)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid.
| Compound Name | [(Z)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid |
|---|---|
| PubChem CID | 50993876 |
| Molecular Formula | C8H10BrN2O5P |
| Molecular Weight | 325.06 g/mol |
| Exact Mass | 323.95 |
| IUPAC Name | [(Z)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid |
| SMILES | O=c1[nH]c(=O)n(C/C=C\CP(=O)(O)O)cc1Br |
| InChI | InChI=1S/C8H10BrN2O5P/c9-6-5-11(8(13)10-7(6)12)3-1-2-4-17(14,15)16/h1-2,5H,3-4H2,(H,10,12,13)(H2,14,15,16)/b2-1- |
| InChIKey | RESRQKJRDNSRDO-UPHRSURJSA-N |
| XLogP | 0.03 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.06 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|