C8H7BrN2O4 — CID 63776895
(E)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enoic acid (PubChem CID 63776895) has the molecular formula C8H7BrN2O4 and a molecular weight of 275.06 g/mol. Its IUPAC name is (E)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enoic acid.
| Compound Name | (E)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 63776895 |
| Molecular Formula | C8H7BrN2O4 |
| Molecular Weight | 275.06 g/mol |
| Exact Mass | 273.96 |
| IUPAC Name | (E)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enoic acid |
| SMILES | O=C(O)/C=C/Cn1cc(Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H7BrN2O4/c9-5-4-11(3-1-2-6(12)13)8(15)10-7(5)14/h1-2,4H,3H2,(H,12,13)(H,10,14,15)/b2-1+ |
| InChIKey | AOLKXGCMXLEAGF-OWOJBTEDSA-N |
| XLogP | -0.06 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.06 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|