C8H10BrN3O2 — CID 66046583
1-[(E)-4-aminobut-2-enyl]-5-bromopyrimidine-2,4-dione (PubChem CID 66046583) has the molecular formula C8H10BrN3O2 and a molecular weight of 260.09 g/mol. Its IUPAC name is 1-[(E)-4-aminobut-2-enyl]-5-bromopyrimidine-2,4-dione.
| Compound Name | 1-[(E)-4-aminobut-2-enyl]-5-bromopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66046583 |
| Molecular Formula | C8H10BrN3O2 |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 1-[(E)-4-aminobut-2-enyl]-5-bromopyrimidine-2,4-dione |
| SMILES | NC/C=C/Cn1cc(Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H10BrN3O2/c9-6-5-12(4-2-1-3-10)8(14)11-7(6)13/h1-2,5H,3-4,10H2,(H,11,13,14)/b2-1+ |
| InChIKey | LVTWORIECQUXCA-OWOJBTEDSA-N |
| XLogP | -0.19 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|