C9H13BrN4O3 — CID 79630896
3-(5-bromo-2,4-dioxopyrimidin-1-yl)-2,2-dimethylpropanehydrazide (PubChem CID 79630896) has the molecular formula C9H13BrN4O3 and a molecular weight of 305.13 g/mol. Its IUPAC name is 3-(5-bromo-2,4-dioxopyrimidin-1-yl)-2,2-dimethylpropanehydrazide.
| Compound Name | 3-(5-bromo-2,4-dioxopyrimidin-1-yl)-2,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 79630896 |
| Molecular Formula | C9H13BrN4O3 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 3-(5-bromo-2,4-dioxopyrimidin-1-yl)-2,2-dimethylpropanehydrazide |
| SMILES | CC(C)(Cn1cc(Br)c(=O)[nH]c1=O)C(=O)NN |
| InChI | InChI=1S/C9H13BrN4O3/c1-9(2,7(16)13-11)4-14-3-5(10)6(15)12-8(14)17/h3H,4,11H2,1-2H3,(H,13,16)(H,12,15,17) |
| InChIKey | YJXLRDDKHWSRLJ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|