C7H14N6 — CID 62362824
1-propan-2-yl-2-(1H-1,2,4-triazol-5-ylmethyl)guanidine (PubChem CID 62362824) has the molecular formula C7H14N6 and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-propan-2-yl-2-(1H-1,2,4-triazol-5-ylmethyl)guanidine.
| Compound Name | 1-propan-2-yl-2-(1H-1,2,4-triazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 62362824 |
| Molecular Formula | C7H14N6 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 1-propan-2-yl-2-(1H-1,2,4-triazol-5-ylmethyl)guanidine |
| SMILES | CC(C)N/C(N)=N/Cc1ncn[nH]1 |
| InChI | InChI=1S/C7H14N6/c1-5(2)12-7(8)9-3-6-10-4-11-13-6/h4-5H,3H2,1-2H3,(H3,8,9,12)(H,10,11,13) |
| InChIKey | NLIIREYVHRIWET-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|