C8H16N6 — CID 130835589
2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-1-propan-2-ylguanidine (PubChem CID 130835589) has the molecular formula C8H16N6 and a molecular weight of 196.26 g/mol. Its IUPAC name is 2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-1-propan-2-ylguanidine.
| Compound Name | 2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-1-propan-2-ylguanidine |
|---|---|
| PubChem CID | 130835589 |
| Molecular Formula | C8H16N6 |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-1-propan-2-ylguanidine |
| SMILES | CC(C)N/C(N)=N/Cc1ncnn1C |
| InChI | InChI=1S/C8H16N6/c1-6(2)13-8(9)10-4-7-11-5-12-14(7)3/h5-6H,4H2,1-3H3,(H3,9,10,13) |
| InChIKey | LRFWKQUPICUSJK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|