C12H21N5O3 — CID 64530796
(2S)-3-methyl-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]pentanoic acid (PubChem CID 64530796) has the molecular formula C12H21N5O3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (2S)-3-methyl-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]pentanoic acid.
| Compound Name | (2S)-3-methyl-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 64530796 |
| Molecular Formula | C12H21N5O3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2S)-3-methyl-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]pentanoic acid |
| SMILES | CCC(C)[C@H](NC(=O)NCCCc1ncn[nH]1)C(=O)O |
| InChI | InChI=1S/C12H21N5O3/c1-3-8(2)10(11(18)19)16-12(20)13-6-4-5-9-14-7-15-17-9/h7-8,10H,3-6H2,1-2H3,(H,18,19)(H2,13,16,20)(H,14,15,17)/t8?,10-/m0/s1 |
| InChIKey | WNEFYEOEWLBOPC-HTLJXXAVSA-N |
| XLogP | 0.54 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|