C9H12N4OS — CID 114693928
N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)thiadiazole-5-carboxamide (PubChem CID 114693928) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)thiadiazole-5-carboxamide.
| Compound Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 114693928 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)thiadiazole-5-carboxamide |
| SMILES | O=C(NCC1=CCNCC1)c1cnns1 |
| InChI | InChI=1S/C9H12N4OS/c14-9(8-6-12-13-15-8)11-5-7-1-3-10-4-2-7/h1,6,10H,2-5H2,(H,11,14) |
| InChIKey | ZAIHBKNVHGZHIW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|