C22H19F2NO4S — CID 24624799
N-[3-benzyl-4-(difluoromethoxy)phenyl]-2-methylsulfonylbenzamide (PubChem CID 24624799) has the molecular formula C22H19F2NO4S and a molecular weight of 431.46 g/mol. Its IUPAC name is N-[3-benzyl-4-(difluoromethoxy)phenyl]-2-methylsulfonylbenzamide.
| Compound Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 24624799 |
| Molecular Formula | C22H19F2NO4S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-2-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)Nc1ccc(OC(F)F)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H19F2NO4S/c1-30(27,28)20-10-6-5-9-18(20)21(26)25-17-11-12-19(29-22(23)24)16(14-17)13-15-7-3-2-4-8-15/h2-12,14,22H,13H2,1H3,(H,25,26) |
| InChIKey | SNAQCUWALDSILK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |