About N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide
N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 24533546) has the molecular formula C23H18F2N4O2
and a molecular weight of 420.42 g/mol. Its IUPAC name is N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide.
Molecular Properties
| Compound Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide |
| PubChem CID | 24533546 |
| Molecular Formula | C23H18F2N4O2 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(Nc1ccc(OC(F)F)c(Cc2ccccc2)c1)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C23H18F2N4O2/c24-23(25)31-21-11-8-19(13-18(21)12-16-4-2-1-3-5-16)28-22(30)17-6-9-20(10-7-17)29-15-26-14-27-29/h1-11,13-15,23H,12H2,(H,28,30) |
| InChIKey | IAUVHBZFJADBMP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide?
The IUPAC name of N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide (CID 24533546) is N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide.
What is the SMILES notation for N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide?
The canonical SMILES for N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide is O=C(Nc1ccc(OC(F)F)c(Cc2ccccc2)c1)c1ccc(-n2cncn2)cc1.
What is the InChIKey of N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide?
The InChIKey is IAUVHBZFJADBMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F2N4O2/c24-23(25)31-21-11-8-19(13-18(21)12-16-4-2-1-3-5-16)28-22(30)17-6-9-20(10-7-17)29-15-26-14-27-29/h1-11,13-15,23H,12H2,(H,28,30).
What are the key properties of N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide?
N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide has a molecular weight of 420.42 g/mol, XLogP of 4.71, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(1,2,4-triazol-1-yl)benzamide is sourced from PubChem (CID 24533546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).