C22H19F2NO3S — CID 157146269
N-[4-[2-(difluoromethoxy)phenyl]-3-oxo-1-phenylbutan-2-yl]thiophene-2-carboxamide (PubChem CID 157146269) has the molecular formula C22H19F2NO3S and a molecular weight of 415.46 g/mol. Its IUPAC name is N-[4-[2-(difluoromethoxy)phenyl]-3-oxo-1-phenylbutan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-(difluoromethoxy)phenyl]-3-oxo-1-phenylbutan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 157146269 |
| Molecular Formula | C22H19F2NO3S |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[4-[2-(difluoromethoxy)phenyl]-3-oxo-1-phenylbutan-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)Cc1ccccc1OC(F)F)c1cccs1 |
| InChI | InChI=1S/C22H19F2NO3S/c23-22(24)28-19-10-5-4-9-16(19)14-18(26)17(13-15-7-2-1-3-8-15)25-21(27)20-11-6-12-29-20/h1-12,17,22H,13-14H2,(H,25,27) |
| InChIKey | LOJGHNSVBROPTR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |