C18H13ClF2N2O4 — CID 8892189
N-[3-chloro-4-(difluoromethoxy)phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 8892189) has the molecular formula C18H13ClF2N2O4 and a molecular weight of 394.76 g/mol. Its IUPAC name is N-[3-chloro-4-(difluoromethoxy)phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 8892189 |
| Molecular Formula | C18H13ClF2N2O4 |
| Molecular Weight | 394.76 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C18H13ClF2N2O4/c19-13-9-10(5-6-14(13)27-18(20)21)22-15(24)7-8-23-16(25)11-3-1-2-4-12(11)17(23)26/h1-6,9,18H,7-8H2,(H,22,24) |
| InChIKey | PHANUVDJLPVCBS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|