C17H15ClF2N2O4 — CID 8696467
2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[3-chloro-4-(difluoromethoxy)phenyl]acetamide (PubChem CID 8696467) has the molecular formula C17H15ClF2N2O4 and a molecular weight of 384.77 g/mol. Its IUPAC name is 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[3-chloro-4-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[3-chloro-4-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 8696467 |
| Molecular Formula | C17H15ClF2N2O4 |
| Molecular Weight | 384.77 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[3-chloro-4-(difluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)[C@H]2CC=CC[C@H]2C1=O)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C17H15ClF2N2O4/c18-12-7-9(5-6-13(12)26-17(19)20)21-14(23)8-22-15(24)10-3-1-2-4-11(10)16(22)25/h1-2,5-7,10-11,17H,3-4,8H2,(H,21,23)/t10-,11+ |
| InChIKey | RQSJNFVAMPLXDU-PHIMTYICSA-N |
| XLogP | 2.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.77 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|