C15H19ClF2N2O3 — CID 110880942
N-[3-chloro-4-(difluoromethoxy)phenyl]-2-[2-(hydroxymethyl)piperidin-1-yl]acetamide (PubChem CID 110880942) has the molecular formula C15H19ClF2N2O3 and a molecular weight of 348.78 g/mol. Its IUPAC name is N-[3-chloro-4-(difluoromethoxy)phenyl]-2-[2-(hydroxymethyl)piperidin-1-yl]acetamide.
| Compound Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-2-[2-(hydroxymethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 110880942 |
| Molecular Formula | C15H19ClF2N2O3 |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-2-[2-(hydroxymethyl)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCCCC1CO)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C15H19ClF2N2O3/c16-12-7-10(4-5-13(12)23-15(17)18)19-14(22)8-20-6-2-1-3-11(20)9-21/h4-5,7,11,15,21H,1-3,6,8-9H2,(H,19,22) |
| InChIKey | RSNVJJIMPBALPS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |