C23H21F2NO3S — CID 18289944
N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide (PubChem CID 18289944) has the molecular formula C23H21F2NO3S and a molecular weight of 429.49 g/mol. Its IUPAC name is N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide.
| Compound Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 18289944 |
| Molecular Formula | C23H21F2NO3S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-[3-benzyl-4-(difluoromethoxy)phenyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2ccc(OC(F)F)c(Cc3ccccc3)c2)s1 |
| InChI | InChI=1S/C23H21F2NO3S/c1-15-7-11-21(30-15)19(27)9-12-22(28)26-18-8-10-20(29-23(24)25)17(14-18)13-16-5-3-2-4-6-16/h2-8,10-11,14,23H,9,12-13H2,1H3,(H,26,28) |
| InChIKey | LGJRMIKYHXKIDY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |