C25H28N4O5S — CID 53120146
6-[4-[(2-acetamido-5-methylphenyl)sulfonylamino]phenoxy]-N-butylpyridine-3-carboxamide (PubChem CID 53120146) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is 6-[4-[(2-acetamido-5-methylphenyl)sulfonylamino]phenoxy]-N-butylpyridine-3-carboxamide.
| Compound Name | 6-[4-[(2-acetamido-5-methylphenyl)sulfonylamino]phenoxy]-N-butylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53120146 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 6-[4-[(2-acetamido-5-methylphenyl)sulfonylamino]phenoxy]-N-butylpyridine-3-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(Oc2ccc(NS(=O)(=O)c3cc(C)ccc3NC(C)=O)cc2)nc1 |
| InChI | InChI=1S/C25H28N4O5S/c1-4-5-14-26-25(31)19-7-13-24(27-16-19)34-21-10-8-20(9-11-21)29-35(32,33)23-15-17(2)6-12-22(23)28-18(3)30/h6-13,15-16,29H,4-5,14H2,1-3H3,(H,26,31)(H,28,30) |
| InChIKey | RFNXNNNYKCDISS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|