C18H13ClN4O3S2 — CID 122309092
5-chloro-N-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]thiophene-2-sulfonamide (PubChem CID 122309092) has the molecular formula C18H13ClN4O3S2 and a molecular weight of 432.91 g/mol. Its IUPAC name is 5-chloro-N-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 122309092 |
| Molecular Formula | C18H13ClN4O3S2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 5-chloro-N-[4-(6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Oc2cc(-n3cccc3)ncn2)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H13ClN4O3S2/c19-15-7-8-18(27-15)28(24,25)22-13-3-5-14(6-4-13)26-17-11-16(20-12-21-17)23-9-1-2-10-23/h1-12,22H |
| InChIKey | VOKRKDXFWCTMTO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |