C17H12ClN5O3S2 — CID 122306400
5-chloro-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]thiophene-2-sulfonamide (PubChem CID 122306400) has the molecular formula C17H12ClN5O3S2 and a molecular weight of 433.90 g/mol. Its IUPAC name is 5-chloro-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 122306400 |
| Molecular Formula | C17H12ClN5O3S2 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | 5-chloro-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Oc2ccc(-n3ccnc3)nn2)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H12ClN5O3S2/c18-14-5-8-17(27-14)28(24,25)22-12-1-3-13(4-2-12)26-16-7-6-15(20-21-16)23-10-9-19-11-23/h1-11,22H |
| InChIKey | ULQOZXCXKSCLJD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |