C17H19N5O3S — CID 122306263
N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]butane-1-sulfonamide (PubChem CID 122306263) has the molecular formula C17H19N5O3S and a molecular weight of 373.44 g/mol. Its IUPAC name is N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]butane-1-sulfonamide.
| Compound Name | N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 122306263 |
| Molecular Formula | C17H19N5O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc(Oc2ccc(-n3ccnc3)nn2)cc1 |
| InChI | InChI=1S/C17H19N5O3S/c1-2-3-12-26(23,24)21-14-4-6-15(7-5-14)25-17-9-8-16(19-20-17)22-11-10-18-13-22/h4-11,13,21H,2-3,12H2,1H3 |
| InChIKey | NVLBPOGRSALDQB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |