C20H16FN5O3S — CID 122306416
1-(3-fluorophenyl)-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]methanesulfonamide (PubChem CID 122306416) has the molecular formula C20H16FN5O3S and a molecular weight of 425.45 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]methanesulfonamide.
| Compound Name | 1-(3-fluorophenyl)-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 122306416 |
| Molecular Formula | C20H16FN5O3S |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1cccc(F)c1)Nc1ccc(Oc2ccc(-n3ccnc3)nn2)cc1 |
| InChI | InChI=1S/C20H16FN5O3S/c21-16-3-1-2-15(12-16)13-30(27,28)25-17-4-6-18(7-5-17)29-20-9-8-19(23-24-20)26-11-10-22-14-26/h1-12,14,25H,13H2 |
| InChIKey | XMUZHQIJOQUBGB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |