C23H23N5O5S — CID 122306490
2,4-diethoxy-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]benzenesulfonamide (PubChem CID 122306490) has the molecular formula C23H23N5O5S and a molecular weight of 481.53 g/mol. Its IUPAC name is 2,4-diethoxy-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]benzenesulfonamide.
| Compound Name | 2,4-diethoxy-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122306490 |
| Molecular Formula | C23H23N5O5S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 2,4-diethoxy-N-[4-(6-imidazol-1-ylpyridazin-3-yl)oxyphenyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(Oc3ccc(-n4ccnc4)nn3)cc2)c(OCC)c1 |
| InChI | InChI=1S/C23H23N5O5S/c1-3-31-19-9-10-21(20(15-19)32-4-2)34(29,30)27-17-5-7-18(8-6-17)33-23-12-11-22(25-26-23)28-14-13-24-16-28/h5-16,27H,3-4H2,1-2H3 |
| InChIKey | RCZMTBKGDNYGFO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |