C22H21N5O4S — CID 122313083
4-ethoxy-N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]benzenesulfonamide (PubChem CID 122313083) has the molecular formula C22H21N5O4S and a molecular weight of 451.51 g/mol. Its IUPAC name is 4-ethoxy-N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122313083 |
| Molecular Formula | C22H21N5O4S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 4-ethoxy-N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(Oc3cc(-n4ccnc4)nc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C22H21N5O4S/c1-3-30-18-8-10-20(11-9-18)32(28,29)26-17-4-6-19(7-5-17)31-22-14-21(24-16(2)25-22)27-13-12-23-15-27/h4-15,26H,3H2,1-2H3 |
| InChIKey | XRPXKRXYMCHTEZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |