C21H17N7O7S — CID 122313345
N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]-4-methyl-3,5-dinitrobenzenesulfonamide (PubChem CID 122313345) has the molecular formula C21H17N7O7S and a molecular weight of 511.48 g/mol. Its IUPAC name is N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]-4-methyl-3,5-dinitrobenzenesulfonamide.
| Compound Name | N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]-4-methyl-3,5-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122313345 |
| Molecular Formula | C21H17N7O7S |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]-4-methyl-3,5-dinitrobenzenesulfonamide |
| SMILES | Cc1nc(Oc2ccc(NS(=O)(=O)c3cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c3)cc2)cc(-n2ccnc2)n1 |
| InChI | InChI=1S/C21H17N7O7S/c1-13-18(27(29)30)9-17(10-19(13)28(31)32)36(33,34)25-15-3-5-16(6-4-15)35-21-11-20(23-14(2)24-21)26-8-7-22-12-26/h3-12,25H,1-2H3 |
| InChIKey | VUIWBRBOMMQKLP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 185.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|